C17H21FN2 — CID 65378148
N-(2-fluorophenyl)-1-(4-propan-2-ylphenyl)ethane-1,2-diamine (PubChem CID 65378148) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1-(4-propan-2-ylphenyl)ethane-1,2-diamine.
| Compound Name | N-(2-fluorophenyl)-1-(4-propan-2-ylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65378148 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-(2-fluorophenyl)-1-(4-propan-2-ylphenyl)ethane-1,2-diamine |
| SMILES | CC(C)c1ccc(C(CN)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H21FN2/c1-12(2)13-7-9-14(10-8-13)17(11-19)20-16-6-4-3-5-15(16)18/h3-10,12,17,20H,11,19H2,1-2H3 |
| InChIKey | XUVCAQRRXWNXEN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |