About 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine
2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine (PubChem CID 65378377) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine.
Molecular Properties
| Compound Name | 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine |
| PubChem CID | 65378377 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine |
| SMILES | Cc1ccc(NC(C)(CN)C(C)C)cc1 |
| InChI | InChI=1S/C13H22N2/c1-10(2)13(4,9-14)15-12-7-5-11(3)6-8-12/h5-8,10,15H,9,14H2,1-4H3 |
| InChIKey | SDYBHMGUYBPKBP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine?
The IUPAC name of 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine (CID 65378377) is 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine.
What is the SMILES notation for 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine?
The canonical SMILES for 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine is Cc1ccc(NC(C)(CN)C(C)C)cc1.
What is the InChIKey of 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine?
The InChIKey is SDYBHMGUYBPKBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-10(2)13(4,9-14)15-12-7-5-11(3)6-8-12/h5-8,10,15H,9,14H2,1-4H3.
What are the key properties of 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine?
2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine has a molecular weight of 206.33 g/mol, XLogP of 2.78, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-2-N-(4-methylphenyl)butane-1,2-diamine is sourced from PubChem (CID 65378377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).