About 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine
4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine (PubChem CID 65378394) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine.
Molecular Properties
| Compound Name | 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine |
| PubChem CID | 65378394 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine |
| SMILES | CC1(C)CC(CN)(NCC2CCCO2)CCO1 |
| InChI | InChI=1S/C13H26N2O2/c1-12(2)9-13(10-14,5-7-17-12)15-8-11-4-3-6-16-11/h11,15H,3-10,14H2,1-2H3 |
| InChIKey | ZIXVKVLDUJHZLA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine?
The IUPAC name of 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine (CID 65378394) is 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine.
What is the SMILES notation for 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine?
The canonical SMILES for 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine is CC1(C)CC(CN)(NCC2CCCO2)CCO1.
What is the InChIKey of 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine?
The InChIKey is ZIXVKVLDUJHZLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-12(2)9-13(10-14,5-7-17-12)15-8-11-4-3-6-16-11/h11,15H,3-10,14H2,1-2H3.
What are the key properties of 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine?
4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine has a molecular weight of 242.36 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-2,2-dimethyl-N-(oxolan-2-ylmethyl)oxan-4-amine is sourced from PubChem (CID 65378394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).