About 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile
1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile (PubChem CID 65378501) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile |
| PubChem CID | 65378501 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile |
| SMILES | Cc1cc(C)cc(CC2(C#N)CCCC(C)C2)c1 |
| InChI | InChI=1S/C17H23N/c1-13-5-4-6-17(10-13,12-18)11-16-8-14(2)7-15(3)9-16/h7-9,13H,4-6,10-11H2,1-3H3 |
| InChIKey | LKIFPRTURTWYOJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile?
The IUPAC name of 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile (CID 65378501) is 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile.
What is the SMILES notation for 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile?
The canonical SMILES for 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile is Cc1cc(C)cc(CC2(C#N)CCCC(C)C2)c1.
What is the InChIKey of 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile?
The InChIKey is LKIFPRTURTWYOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N/c1-13-5-4-6-17(10-13,12-18)11-16-8-14(2)7-15(3)9-16/h7-9,13H,4-6,10-11H2,1-3H3.
What are the key properties of 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile?
1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile has a molecular weight of 241.38 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethylphenyl)methyl]-3-methylcyclohexane-1-carbonitrile is sourced from PubChem (CID 65378501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).