C12H17BrN2O4S — CID 65380192
4-bromo-N-(4-methoxybutan-2-yl)-3-sulfamoylbenzamide (PubChem CID 65380192) has the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. Its IUPAC name is 4-bromo-N-(4-methoxybutan-2-yl)-3-sulfamoylbenzamide.
| Compound Name | 4-bromo-N-(4-methoxybutan-2-yl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65380192 |
| Molecular Formula | C12H17BrN2O4S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 4-bromo-N-(4-methoxybutan-2-yl)-3-sulfamoylbenzamide |
| SMILES | COCCC(C)NC(=O)c1ccc(Br)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H17BrN2O4S/c1-8(5-6-19-2)15-12(16)9-3-4-10(13)11(7-9)20(14,17)18/h3-4,7-8H,5-6H2,1-2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | DYNBPVTZQOTFCA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |