About 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine
1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine (PubChem CID 65380315) has the molecular formula C14H14Cl2N2
and a molecular weight of 281.19 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine |
| PubChem CID | 65380315 |
| Molecular Formula | C14H14Cl2N2 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine |
| SMILES | NCC(Nc1ccccc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2/c15-11-6-10(7-12(16)8-11)14(9-17)18-13-4-2-1-3-5-13/h1-8,14,18H,9,17H2 |
| InChIKey | BUGBTOOERVSXLJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine?
The IUPAC name of 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine (CID 65380315) is 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine.
What is the SMILES notation for 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine?
The canonical SMILES for 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine is NCC(Nc1ccccc1)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine?
The InChIKey is BUGBTOOERVSXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2/c15-11-6-10(7-12(16)8-11)14(9-17)18-13-4-2-1-3-5-13/h1-8,14,18H,9,17H2.
What are the key properties of 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine?
1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine has a molecular weight of 281.19 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dichlorophenyl)-N-phenylethane-1,2-diamine is sourced from PubChem (CID 65380315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).