About 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride
1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride (PubChem CID 6538108) has the molecular formula C15H25ClN2
and a molecular weight of 268.83 g/mol. Its IUPAC name is 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride.
Molecular Properties
| Compound Name | 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride |
| PubChem CID | 6538108 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride |
| SMILES | C(/C=C/C=C/N1CCCCC1)=[N+]1CCCCC1.[Cl-] |
| InChI | InChI=1S/C15H25N2.ClH/c1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17;/h3,8-9,14-15H,1-2,4-7,10-13H2;1H/q+1;/p-1 |
| InChIKey | ZDQJHKFXTFWZCY-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride?
The IUPAC name of 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride (CID 6538108) is 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride.
What is the SMILES notation for 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride?
The canonical SMILES for 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride is C(/C=C/C=C/N1CCCCC1)=[N+]1CCCCC1.[Cl-].
What is the InChIKey of 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride?
The InChIKey is ZDQJHKFXTFWZCY-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H25N2.ClH/c1-4-10-16(11-5-1)14-8-3-9-15-17-12-6-2-7-13-17;/h3,8-9,14-15H,1-2,4-7,10-13H2;1H/q+1;/p-1.
What are the key properties of 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride?
1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride has a molecular weight of 268.83 g/mol, XLogP of -0.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E,3E)-5-piperidin-1-ium-1-ylidenepenta-1,3-dienyl]piperidine chloride is sourced from PubChem (CID 6538108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).