C11H12N8 — CID 653811
5-(4-ethylphenyl)-2-(2H-tetrazol-5-ylmethyl)tetrazole (PubChem CID 653811) has the molecular formula C11H12N8 and a molecular weight of 256.27 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-2-(2H-tetrazol-5-ylmethyl)tetrazole.
| Compound Name | 5-(4-ethylphenyl)-2-(2H-tetrazol-5-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 653811 |
| Molecular Formula | C11H12N8 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 5-(4-ethylphenyl)-2-(2H-tetrazol-5-ylmethyl)tetrazole |
| SMILES | CCc1ccc(-c2nnn(Cc3nn[nH]n3)n2)cc1 |
| InChI | InChI=1S/C11H12N8/c1-2-8-3-5-9(6-4-8)11-14-18-19(15-11)7-10-12-16-17-13-10/h3-6H,2,7H2,1H3,(H,12,13,16,17) |
| InChIKey | AGZQPXOKARTYDZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |