C12H15NO5S — CID 65382037
cyclopropylmethyl 4-methoxy-3-sulfamoylbenzoate (PubChem CID 65382037) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is cyclopropylmethyl 4-methoxy-3-sulfamoylbenzoate.
| Compound Name | cyclopropylmethyl 4-methoxy-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 65382037 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | cyclopropylmethyl 4-methoxy-3-sulfamoylbenzoate |
| SMILES | COc1ccc(C(=O)OCC2CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H15NO5S/c1-17-10-5-4-9(6-11(10)19(13,15)16)12(14)18-7-8-2-3-8/h4-6,8H,2-3,7H2,1H3,(H2,13,15,16) |
| InChIKey | UUSNYBDUERUADW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |