C10H11BrFNO4S — CID 65382220
propyl 5-bromo-2-fluoro-3-sulfamoylbenzoate (PubChem CID 65382220) has the molecular formula C10H11BrFNO4S and a molecular weight of 340.17 g/mol. Its IUPAC name is propyl 5-bromo-2-fluoro-3-sulfamoylbenzoate.
| Compound Name | propyl 5-bromo-2-fluoro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 65382220 |
| Molecular Formula | C10H11BrFNO4S |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | propyl 5-bromo-2-fluoro-3-sulfamoylbenzoate |
| SMILES | CCCOC(=O)c1cc(Br)cc(S(N)(=O)=O)c1F |
| InChI | InChI=1S/C10H11BrFNO4S/c1-2-3-17-10(14)7-4-6(11)5-8(9(7)12)18(13,15)16/h4-5H,2-3H2,1H3,(H2,13,15,16) |
| InChIKey | NSRNFIXKKCYNGS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |