About 2-butoxyethyl 3-sulfamoylbenzoate
2-butoxyethyl 3-sulfamoylbenzoate (PubChem CID 65382492) has the molecular formula C13H19NO5S
and a molecular weight of 301.36 g/mol. Its IUPAC name is 2-butoxyethyl 3-sulfamoylbenzoate.
Molecular Properties
| Compound Name | 2-butoxyethyl 3-sulfamoylbenzoate |
| PubChem CID | 65382492 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-butoxyethyl 3-sulfamoylbenzoate |
| SMILES | CCCCOCCOC(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-2-3-7-18-8-9-19-13(15)11-5-4-6-12(10-11)20(14,16)17/h4-6,10H,2-3,7-9H2,1H3,(H2,14,16,17) |
| InChIKey | JLTXDVIHTAUMFK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethyl 3-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethyl 3-sulfamoylbenzoate?
The IUPAC name of 2-butoxyethyl 3-sulfamoylbenzoate (CID 65382492) is 2-butoxyethyl 3-sulfamoylbenzoate.
What is the SMILES notation for 2-butoxyethyl 3-sulfamoylbenzoate?
The canonical SMILES for 2-butoxyethyl 3-sulfamoylbenzoate is CCCCOCCOC(=O)c1cccc(S(N)(=O)=O)c1.
What is the InChIKey of 2-butoxyethyl 3-sulfamoylbenzoate?
The InChIKey is JLTXDVIHTAUMFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5S/c1-2-3-7-18-8-9-19-13(15)11-5-4-6-12(10-11)20(14,16)17/h4-6,10H,2-3,7-9H2,1H3,(H2,14,16,17).
What are the key properties of 2-butoxyethyl 3-sulfamoylbenzoate?
2-butoxyethyl 3-sulfamoylbenzoate has a molecular weight of 301.36 g/mol, XLogP of 1.31, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl 3-sulfamoylbenzoate is sourced from PubChem (CID 65382492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).