About 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol
2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol (PubChem CID 65382561) has the molecular formula C8H18N2O3S
and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol |
| PubChem CID | 65382561 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol |
| SMILES | NCC1(NCCO)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H18N2O3S/c9-7-8(10-3-4-11)1-5-14(12,13)6-2-8/h10-11H,1-7,9H2 |
| InChIKey | AJWIZKJFVBXFCC-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol?
The IUPAC name of 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol (CID 65382561) is 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol.
What is the SMILES notation for 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol?
The canonical SMILES for 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol is NCC1(NCCO)CCS(=O)(=O)CC1.
What is the InChIKey of 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol?
The InChIKey is AJWIZKJFVBXFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O3S/c9-7-8(10-3-4-11)1-5-14(12,13)6-2-8/h10-11H,1-7,9H2.
What are the key properties of 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol?
2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol has a molecular weight of 222.31 g/mol, XLogP of -1.53, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(aminomethyl)-1,1-dioxothian-4-yl]amino]ethanol is sourced from PubChem (CID 65382561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).