C18H17N5O2S2 — CID 653834
N-(furan-2-ylmethyl)-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide (PubChem CID 653834) has the molecular formula C18H17N5O2S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 653834 |
| Molecular Formula | C18H17N5O2S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-5-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2c3c4c(sc3ncn12)CCCC4)NCc1ccco1 |
| InChI | InChI=1S/C18H17N5O2S2/c24-14(19-8-11-4-3-7-25-11)9-26-18-22-21-16-15-12-5-1-2-6-13(12)27-17(15)20-10-23(16)18/h3-4,7,10H,1-2,5-6,8-9H2,(H,19,24) |
| InChIKey | KWALMHOWUZIUQB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |