C13H16N2OS — CID 65383986
N-(2-methoxyphenyl)-1-thiophen-2-ylethane-1,2-diamine (PubChem CID 65383986) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1-thiophen-2-ylethane-1,2-diamine.
| Compound Name | N-(2-methoxyphenyl)-1-thiophen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 65383986 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-(2-methoxyphenyl)-1-thiophen-2-ylethane-1,2-diamine |
| SMILES | COc1ccccc1NC(CN)c1cccs1 |
| InChI | InChI=1S/C13H16N2OS/c1-16-12-6-3-2-5-10(12)15-11(9-14)13-7-4-8-17-13/h2-8,11,15H,9,14H2,1H3 |
| InChIKey | QFUAHMWVNVRXCN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |