About N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine
N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine (PubChem CID 65386036) has the molecular formula C12H22N2S
and a molecular weight of 226.39 g/mol. Its IUPAC name is N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine |
| PubChem CID | 65386036 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine |
| SMILES | CCC(C)NC(CN)c1cc(C)sc1C |
| InChI | InChI=1S/C12H22N2S/c1-5-8(2)14-12(7-13)11-6-9(3)15-10(11)4/h6,8,12,14H,5,7,13H2,1-4H3 |
| InChIKey | HSSNUTPDDXHXTI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine?
The IUPAC name of N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine (CID 65386036) is N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine.
What is the SMILES notation for N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine?
The canonical SMILES for N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine is CCC(C)NC(CN)c1cc(C)sc1C.
What is the InChIKey of N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine?
The InChIKey is HSSNUTPDDXHXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2S/c1-5-8(2)14-12(7-13)11-6-9(3)15-10(11)4/h6,8,12,14H,5,7,13H2,1-4H3.
What are the key properties of N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine?
N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine has a molecular weight of 226.39 g/mol, XLogP of 2.75, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-1-(2,5-dimethylthiophen-3-yl)ethane-1,2-diamine is sourced from PubChem (CID 65386036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).