About N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide
N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide (PubChem CID 65386276) has the molecular formula C11H16N2O4S
and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide |
| PubChem CID | 65386276 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide |
| SMILES | Cc1oc(C(=O)N(C)CC2CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16N2O4S/c1-7-10(18(12,15)16)5-9(17-7)11(14)13(2)6-8-3-4-8/h5,8H,3-4,6H2,1-2H3,(H2,12,15,16) |
| InChIKey | CXVAYWUNZQVIOL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide?
The IUPAC name of N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide (CID 65386276) is N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide.
What is the SMILES notation for N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide?
The canonical SMILES for N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide is Cc1oc(C(=O)N(C)CC2CC2)cc1S(N)(=O)=O.
What is the InChIKey of N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide?
The InChIKey is CXVAYWUNZQVIOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4S/c1-7-10(18(12,15)16)5-9(17-7)11(14)13(2)6-8-3-4-8/h5,8H,3-4,6H2,1-2H3,(H2,12,15,16).
What are the key properties of N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide?
N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide has a molecular weight of 272.33 g/mol, XLogP of 0.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-N,5-dimethyl-4-sulfamoylfuran-2-carboxamide is sourced from PubChem (CID 65386276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).