About 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide
5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65386321) has the molecular formula C10H16N4O5S2
and a molecular weight of 336.40 g/mol. Its IUPAC name is 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| PubChem CID | 65386321 |
| Molecular Formula | C10H16N4O5S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NC2(C)CCS(=O)(=O)C2)c1S(N)(=O)=O |
| InChI | InChI=1S/C10H16N4O5S2/c1-6-8(21(11,18)19)7(14-13-6)9(15)12-10(2)3-4-20(16,17)5-10/h3-5H2,1-2H3,(H,12,15)(H,13,14)(H2,11,18,19) |
| InChIKey | APFAZYDTZPSAKC-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide?
The IUPAC name of 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (CID 65386321) is 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide?
The canonical SMILES for 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide is Cc1[nH]nc(C(=O)NC2(C)CCS(=O)(=O)C2)c1S(N)(=O)=O.
What is the InChIKey of 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide?
The InChIKey is APFAZYDTZPSAKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O5S2/c1-6-8(21(11,18)19)7(14-13-6)9(15)12-10(2)3-4-20(16,17)5-10/h3-5H2,1-2H3,(H,12,15)(H,13,14)(H2,11,18,19).
What are the key properties of 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide?
5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide has a molecular weight of 336.40 g/mol, XLogP of -1.33, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-4-sulfamoyl-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 65386321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).