C17H20ClN3O2 — CID 653866
3-chloro-4-(4-methylpiperazin-1-yl)-1-(2-phenylethyl)pyrrole-2,5-dione (PubChem CID 653866) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-chloro-4-(4-methylpiperazin-1-yl)-1-(2-phenylethyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(4-methylpiperazin-1-yl)-1-(2-phenylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 653866 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-chloro-4-(4-methylpiperazin-1-yl)-1-(2-phenylethyl)pyrrole-2,5-dione |
| SMILES | CN1CCN(C2=C(Cl)C(=O)N(CCc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-19-9-11-20(12-10-19)15-14(18)16(22)21(17(15)23)8-7-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3 |
| InChIKey | JLAYDOAARQTGFI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|