C11H18N4O4S — CID 65386706
5-methyl-N-(oxan-3-ylmethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide (PubChem CID 65386706) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-methyl-N-(oxan-3-ylmethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-(oxan-3-ylmethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65386706 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-methyl-N-(oxan-3-ylmethyl)-4-sulfamoyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(=O)NCC2CCCOC2)c1S(N)(=O)=O |
| InChI | InChI=1S/C11H18N4O4S/c1-7-10(20(12,17)18)9(15-14-7)11(16)13-5-8-3-2-4-19-6-8/h8H,2-6H2,1H3,(H,13,16)(H,14,15)(H2,12,17,18) |
| InChIKey | QVHWYAQTVVAWAO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |