About 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one
9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one (PubChem CID 6538742) has the molecular formula C16H10BrIN2O
and a molecular weight of 453.08 g/mol. Its IUPAC name is 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
| PubChem CID | 6538742 |
| Molecular Formula | C16H10BrIN2O |
| Molecular Weight | 453.08 g/mol |
| Exact Mass | 451.90 |
| IUPAC Name | 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
| SMILES | O=C1Cc2c([nH]c3ccc(Br)cc23)-c2cc(I)ccc2N1 |
| InChI | InChI=1S/C16H10BrIN2O/c17-8-1-3-13-10(5-8)11-7-15(21)19-14-4-2-9(18)6-12(14)16(11)20-13/h1-6,20H,7H2,(H,19,21) |
| InChIKey | JKVBIBIZBZBAKL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.08 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one?
The IUPAC name of 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one (CID 6538742) is 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one.
What is the SMILES notation for 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one?
The canonical SMILES for 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one is O=C1Cc2c([nH]c3ccc(Br)cc23)-c2cc(I)ccc2N1.
What is the InChIKey of 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one?
The InChIKey is JKVBIBIZBZBAKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrIN2O/c17-8-1-3-13-10(5-8)11-7-15(21)19-14-4-2-9(18)6-12(14)16(11)20-13/h1-6,20H,7H2,(H,19,21).
What are the key properties of 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one?
9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one has a molecular weight of 453.08 g/mol, XLogP of 4.70, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-2-iodo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one is sourced from PubChem (CID 6538742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).