C20H20BrN3O2 — CID 6538760
3-(4-aminobutoxy)-9-bromo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one (PubChem CID 6538760) has the molecular formula C20H20BrN3O2 and a molecular weight of 414.30 g/mol. Its IUPAC name is 3-(4-aminobutoxy)-9-bromo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one.
| Compound Name | 3-(4-aminobutoxy)-9-bromo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 6538760 |
| Molecular Formula | C20H20BrN3O2 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 3-(4-aminobutoxy)-9-bromo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
| SMILES | NCCCCOc1ccc2c(c1)NC(=O)Cc1c-2[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C20H20BrN3O2/c21-12-3-6-17-15(9-12)16-11-19(25)23-18-10-13(26-8-2-1-7-22)4-5-14(18)20(16)24-17/h3-6,9-10,24H,1-2,7-8,11,22H2,(H,23,25) |
| InChIKey | MAQBOTRSBYDGOL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|