About 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine
6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 6538772) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 6538772 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | COc1cc(OC)cc(-c2cc3nccnc3[nH]2)c1 |
| InChI | InChI=1S/C14H13N3O2/c1-18-10-5-9(6-11(7-10)19-2)12-8-13-14(17-12)16-4-3-15-13/h3-8H,1-2H3,(H,16,17) |
| InChIKey | YOIQNVSHTXFKAL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine (CID 6538772) is 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine is COc1cc(OC)cc(-c2cc3nccnc3[nH]2)c1.
What is the InChIKey of 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is YOIQNVSHTXFKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c1-18-10-5-9(6-11(7-10)19-2)12-8-13-14(17-12)16-4-3-15-13/h3-8H,1-2H3,(H,16,17).
What are the key properties of 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine?
6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 255.28 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 6538772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).