C20H25N3O — CID 6538788
7-heptyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 6538788) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 7-heptyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 7-heptyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 6538788 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 7-heptyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | CCCCCCCc1c(-c2ccc(OC)cc2)[nH]c2nccnc12 |
| InChI | InChI=1S/C20H25N3O/c1-3-4-5-6-7-8-17-18(15-9-11-16(24-2)12-10-15)23-20-19(17)21-13-14-22-20/h9-14H,3-8H2,1-2H3,(H,22,23) |
| InChIKey | OCQOWMWCDNLMCO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|