About ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid
ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid (PubChem CID 653879) has the molecular formula C15H24N2O7
and a molecular weight of 344.36 g/mol. Its IUPAC name is ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid.
Molecular Properties
| Compound Name | ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid |
| PubChem CID | 653879 |
| Molecular Formula | C15H24N2O7 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid |
| SMILES | CCOC(=O)C1CCCN(CC(=O)NC2CC2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H22N2O3.C2H2O4/c1-2-18-13(17)10-4-3-7-15(8-10)9-12(16)14-11-5-6-11;3-1(4)2(5)6/h10-11H,2-9H2,1H3,(H,14,16);(H,3,4)(H,5,6) |
| InChIKey | VJSNYWIWMSZCNP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid?
The IUPAC name of ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid (CID 653879) is ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid.
What is the SMILES notation for ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid?
The canonical SMILES for ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid is CCOC(=O)C1CCCN(CC(=O)NC2CC2)C1.O=C(O)C(=O)O.
What is the InChIKey of ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid?
The InChIKey is VJSNYWIWMSZCNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3.C2H2O4/c1-2-18-13(17)10-4-3-7-15(8-10)9-12(16)14-11-5-6-11;3-1(4)2(5)6/h10-11H,2-9H2,1H3,(H,14,16);(H,3,4)(H,5,6).
What are the key properties of ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid?
ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid has a molecular weight of 344.36 g/mol, XLogP of -0.30, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-(cyclopropylamino)-2-oxoethyl]piperidine-3-carboxylate;oxalic acid is sourced from PubChem (CID 653879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).