About [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate
[4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate (PubChem CID 6538791) has the molecular formula C15H16N4O3S
and a molecular weight of 332.39 g/mol. Its IUPAC name is [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate.
Molecular Properties
| Compound Name | [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate |
| PubChem CID | 6538791 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate |
| SMILES | Cc1c(-c2ccc(OS(=O)(=O)N(C)C)cc2)[nH]c2nccnc12 |
| InChI | InChI=1S/C15H16N4O3S/c1-10-13(18-15-14(10)16-8-9-17-15)11-4-6-12(7-5-11)22-23(20,21)19(2)3/h4-9H,1-3H3,(H,17,18) |
| InChIKey | HVIKNWLSYBPGOG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate?
The IUPAC name of [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate (CID 6538791) is [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate.
What is the SMILES notation for [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate?
The canonical SMILES for [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate is Cc1c(-c2ccc(OS(=O)(=O)N(C)C)cc2)[nH]c2nccnc12.
What is the InChIKey of [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate?
The InChIKey is HVIKNWLSYBPGOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O3S/c1-10-13(18-15-14(10)16-8-9-17-15)11-4-6-12(7-5-11)22-23(20,21)19(2)3/h4-9H,1-3H3,(H,17,18).
What are the key properties of [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate?
[4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate has a molecular weight of 332.39 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(7-methyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] N,N-dimethylsulfamate is sourced from PubChem (CID 6538791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).