About 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine
6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 6538809) has the molecular formula C15H13N3O2
and a molecular weight of 267.29 g/mol. Its IUPAC name is 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 6538809 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | c1cnc2[nH]c(-c3ccc(C4OCCO4)cc3)cc2n1 |
| InChI | InChI=1S/C15H13N3O2/c1-3-11(15-19-7-8-20-15)4-2-10(1)12-9-13-14(18-12)17-6-5-16-13/h1-6,9,15H,7-8H2,(H,17,18) |
| InChIKey | BTVBGFIJVYXNFJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine (CID 6538809) is 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine is c1cnc2[nH]c(-c3ccc(C4OCCO4)cc3)cc2n1.
What is the InChIKey of 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is BTVBGFIJVYXNFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2/c1-3-11(15-19-7-8-20-15)4-2-10(1)12-9-13-14(18-12)17-6-5-16-13/h1-6,9,15H,7-8H2,(H,17,18).
What are the key properties of 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine?
6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 267.29 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(1,3-dioxolan-2-yl)phenyl]-5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 6538809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).