C25H33N3O3Si — CID 6538848
2-[2-(dimethylamino)ethyl]-5-methyl-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 6538848) has the molecular formula C25H33N3O3Si and a molecular weight of 451.64 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-5-methyl-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 2-[2-(dimethylamino)ethyl]-5-methyl-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 6538848 |
| Molecular Formula | C25H33N3O3Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-5-methyl-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | Cc1cc2c(c3c4ccccc4n(COCC[Si](C)(C)C)c13)C(=O)N(CCN(C)C)C2=O |
| InChI | InChI=1S/C25H33N3O3Si/c1-17-15-19-22(25(30)27(24(19)29)12-11-26(2)3)21-18-9-7-8-10-20(18)28(23(17)21)16-31-13-14-32(4,5)6/h7-10,15H,11-14,16H2,1-6H3 |
| InChIKey | MAJHDXHPKWRWEB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|