About 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine
4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine (PubChem CID 6538880) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine.
Molecular Properties
| Compound Name | 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine |
| PubChem CID | 6538880 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine |
| SMILES | Cc1nnc2n[nH]c(N)c2c1C |
| InChI | InChI=1S/C7H9N5/c1-3-4(2)9-11-7-5(3)6(8)10-12-7/h1-2H3,(H3,8,10,11,12) |
| InChIKey | RVIXOTSPJLNAEI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine?
The IUPAC name of 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine (CID 6538880) is 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine.
What is the SMILES notation for 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine?
The canonical SMILES for 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine is Cc1nnc2n[nH]c(N)c2c1C.
What is the InChIKey of 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine?
The InChIKey is RVIXOTSPJLNAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-3-4(2)9-11-7-5(3)6(8)10-12-7/h1-2H3,(H3,8,10,11,12).
What are the key properties of 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine?
4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine has a molecular weight of 163.18 g/mol, XLogP of 0.55, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2H-pyrazolo[3,4-c]pyridazin-3-amine is sourced from PubChem (CID 6538880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).