About 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine
1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine (PubChem CID 6538891) has the molecular formula C24H19N5
and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine.
Molecular Properties
| Compound Name | 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine |
| PubChem CID | 6538891 |
| Molecular Formula | C24H19N5 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine |
| SMILES | Nc1nn(Cc2ccccc2)c2nnc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C24H19N5/c25-23-21-20(18-12-6-2-7-13-18)22(19-14-8-3-9-15-19)26-27-24(21)29(28-23)16-17-10-4-1-5-11-17/h1-15H,16H2,(H2,25,28) |
| InChIKey | RSXBXHUMUOJHGZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine?
The IUPAC name of 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine (CID 6538891) is 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine.
What is the SMILES notation for 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine?
The canonical SMILES for 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine is Nc1nn(Cc2ccccc2)c2nnc(-c3ccccc3)c(-c3ccccc3)c12.
What is the InChIKey of 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine?
The InChIKey is RSXBXHUMUOJHGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N5/c25-23-21-20(18-12-6-2-7-13-18)22(19-14-8-3-9-15-19)26-27-24(21)29(28-23)16-17-10-4-1-5-11-17/h1-15H,16H2,(H2,25,28).
What are the key properties of 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine?
1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine has a molecular weight of 377.45 g/mol, XLogP of 4.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,5-diphenylpyrazolo[3,4-c]pyridazin-3-amine is sourced from PubChem (CID 6538891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).