About 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea
1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea (PubChem CID 6538894) has the molecular formula C12H12N6O2
and a molecular weight of 272.27 g/mol. Its IUPAC name is 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea |
| PubChem CID | 6538894 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea |
| SMILES | CCNC(=O)Nc1n[nH]c2nnc(-c3ccco3)cc12 |
| InChI | InChI=1S/C12H12N6O2/c1-2-13-12(19)14-10-7-6-8(9-4-3-5-20-9)15-17-11(7)18-16-10/h3-6H,2H2,1H3,(H3,13,14,16,17,18,19) |
| InChIKey | ZUDRUSBBDYWIIP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea?
The IUPAC name of 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea (CID 6538894) is 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea.
What is the SMILES notation for 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea?
The canonical SMILES for 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea is CCNC(=O)Nc1n[nH]c2nnc(-c3ccco3)cc12.
What is the InChIKey of 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea?
The InChIKey is ZUDRUSBBDYWIIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N6O2/c1-2-13-12(19)14-10-7-6-8(9-4-3-5-20-9)15-17-11(7)18-16-10/h3-6H,2H2,1H3,(H3,13,14,16,17,18,19).
What are the key properties of 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea?
1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea has a molecular weight of 272.27 g/mol, XLogP of 1.75, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[5-(furan-2-yl)-1H-pyrazolo[3,4-c]pyridazin-3-yl]urea is sourced from PubChem (CID 6538894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).