About (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one
(2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one (PubChem CID 6538898) has the molecular formula C21H21NO4
and a molecular weight of 351.40 g/mol. Its IUPAC name is (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one.
Molecular Properties
| Compound Name | (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one |
| PubChem CID | 6538898 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one |
| SMILES | CN1CCC(c2c(O)cc(O)c3c2O/C(=C\c2ccccc2)C3=O)CC1 |
| InChI | InChI=1S/C21H21NO4/c1-22-9-7-14(8-10-22)18-15(23)12-16(24)19-20(25)17(26-21(18)19)11-13-5-3-2-4-6-13/h2-6,11-12,14,23-24H,7-10H2,1H3/b17-11- |
| InChIKey | HGFLDVQTDYSNRS-BOPFTXTBSA-N |
| XLogP | 3.52 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one?
The IUPAC name of (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one (CID 6538898) is (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one.
What is the SMILES notation for (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one?
The canonical SMILES for (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one is CN1CCC(c2c(O)cc(O)c3c2O/C(=C\c2ccccc2)C3=O)CC1.
What is the InChIKey of (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one?
The InChIKey is HGFLDVQTDYSNRS-BOPFTXTBSA-N. The full InChI is InChI=1S/C21H21NO4/c1-22-9-7-14(8-10-22)18-15(23)12-16(24)19-20(25)17(26-21(18)19)11-13-5-3-2-4-6-13/h2-6,11-12,14,23-24H,7-10H2,1H3/b17-11-.
What are the key properties of (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one?
(2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one has a molecular weight of 351.40 g/mol, XLogP of 3.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-benzylidene-4,6-dihydroxy-7-(1-methylpiperidin-4-yl)-1-benzofuran-3-one is sourced from PubChem (CID 6538898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).