C20H26N6O — CID 6538914
[(2S)-1-[6-(benzylamino)-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 6538914) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is [(2S)-1-[6-(benzylamino)-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[6-(benzylamino)-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 6538914 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [(2S)-1-[6-(benzylamino)-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | CC(C)n1cnc2c(NCc3ccccc3)nc(N3CCC[C@H]3CO)nc21 |
| InChI | InChI=1S/C20H26N6O/c1-14(2)26-13-22-17-18(21-11-15-7-4-3-5-8-15)23-20(24-19(17)26)25-10-6-9-16(25)12-27/h3-5,7-8,13-14,16,27H,6,9-12H2,1-2H3,(H,21,23,24)/t16-/m0/s1 |
| InChIKey | AYNMLENGSDFFOL-INIZCTEOSA-N |
| XLogP | 2.98 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |