About 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine
4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine (PubChem CID 65390155) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine |
| PubChem CID | 65390155 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine |
| SMILES | CCC1CCC(c2ncnc(N)n2)CC1 |
| InChI | InChI=1S/C11H18N4/c1-2-8-3-5-9(6-4-8)10-13-7-14-11(12)15-10/h7-9H,2-6H2,1H3,(H2,12,13,14,15) |
| InChIKey | NZRRMIJFMXLSNQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine?
The IUPAC name of 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine (CID 65390155) is 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine?
The canonical SMILES for 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine is CCC1CCC(c2ncnc(N)n2)CC1.
What is the InChIKey of 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine?
The InChIKey is NZRRMIJFMXLSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4/c1-2-8-3-5-9(6-4-8)10-13-7-14-11(12)15-10/h7-9H,2-6H2,1H3,(H2,12,13,14,15).
What are the key properties of 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine?
4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine has a molecular weight of 206.29 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethylcyclohexyl)-1,3,5-triazin-2-amine is sourced from PubChem (CID 65390155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).