About 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine
2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine (PubChem CID 65390231) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine.
Molecular Properties
| Compound Name | 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine |
| PubChem CID | 65390231 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine |
| SMILES | CC1(C)CCC(C(N)CC2CC2)CC1 |
| InChI | InChI=1S/C13H25N/c1-13(2)7-5-11(6-8-13)12(14)9-10-3-4-10/h10-12H,3-9,14H2,1-2H3 |
| InChIKey | NGRBVMSGCFOJCY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine?
The IUPAC name of 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine (CID 65390231) is 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine.
What is the SMILES notation for 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine?
The canonical SMILES for 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine is CC1(C)CCC(C(N)CC2CC2)CC1.
What is the InChIKey of 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine?
The InChIKey is NGRBVMSGCFOJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-13(2)7-5-11(6-8-13)12(14)9-10-3-4-10/h10-12H,3-9,14H2,1-2H3.
What are the key properties of 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine?
2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine has a molecular weight of 195.35 g/mol, XLogP of 3.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine is sourced from PubChem (CID 65390231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).