C13H25N — CID 65390231
2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine (PubChem CID 65390231) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine.
| Compound Name | 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 65390231 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 2-cyclopropyl-1-(4,4-dimethylcyclohexyl)ethanamine |
| SMILES | CC1(C)CCC(C(N)CC2CC2)CC1 |
| InChI | InChI=1S/C13H25N/c1-13(2)7-5-11(6-8-13)12(14)9-10-3-4-10/h10-12H,3-9,14H2,1-2H3 |
| InChIKey | NGRBVMSGCFOJCY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |