C15H25NO — CID 65390247
N-[(4,4-dimethylcyclohexyl)-(furan-2-yl)methyl]ethanamine (PubChem CID 65390247) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[(4,4-dimethylcyclohexyl)-(furan-2-yl)methyl]ethanamine.
| Compound Name | N-[(4,4-dimethylcyclohexyl)-(furan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 65390247 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-[(4,4-dimethylcyclohexyl)-(furan-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccco1)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H25NO/c1-4-16-14(13-6-5-11-17-13)12-7-9-15(2,3)10-8-12/h5-6,11-12,14,16H,4,7-10H2,1-3H3 |
| InChIKey | PJTSNCXMEQRWKC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |