About 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione
4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione (PubChem CID 6539141) has the molecular formula C9H7BrN2O2S
and a molecular weight of 287.14 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione |
| PubChem CID | 6539141 |
| Molecular Formula | C9H7BrN2O2S |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione |
| SMILES | Cn1sc(=O)n(-c2ccc(Br)cc2)c1=O |
| InChI | InChI=1S/C9H7BrN2O2S/c1-11-8(13)12(9(14)15-11)7-4-2-6(10)3-5-7/h2-5H,1H3 |
| InChIKey | ZQPFDLGDWZNXJY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione?
The IUPAC name of 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione (CID 6539141) is 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione.
What is the SMILES notation for 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione?
The canonical SMILES for 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione is Cn1sc(=O)n(-c2ccc(Br)cc2)c1=O.
What is the InChIKey of 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione?
The InChIKey is ZQPFDLGDWZNXJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrN2O2S/c1-11-8(13)12(9(14)15-11)7-4-2-6(10)3-5-7/h2-5H,1H3.
What are the key properties of 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione?
4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione has a molecular weight of 287.14 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2-methyl-1,2,4-thiadiazolidine-3,5-dione is sourced from PubChem (CID 6539141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).