About 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one
2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one (PubChem CID 6539150) has the molecular formula C14H10N2OS2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one.
Molecular Properties
| Compound Name | 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one |
| PubChem CID | 6539150 |
| Molecular Formula | C14H10N2OS2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one |
| SMILES | O=c1sn(-c2ccccc2)c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C14H10N2OS2/c17-14-15(11-7-3-1-4-8-11)13(18)16(19-14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | PRDNKKPIALEDSB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one?
The IUPAC name of 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one (CID 6539150) is 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one.
What is the SMILES notation for 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one?
The canonical SMILES for 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one is O=c1sn(-c2ccccc2)c(=S)n1-c1ccccc1.
What is the InChIKey of 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one?
The InChIKey is PRDNKKPIALEDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2OS2/c17-14-15(11-7-3-1-4-8-11)13(18)16(19-14)12-9-5-2-6-10-12/h1-10H.
What are the key properties of 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one?
2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one has a molecular weight of 286.38 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenyl-3-sulfanylidene-1,2,4-thiadiazolidin-5-one is sourced from PubChem (CID 6539150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).