About 4-methyl-1,2,4-dithiazolidine-3,5-dione
4-methyl-1,2,4-dithiazolidine-3,5-dione (PubChem CID 6539161) has the molecular formula C3H3NO2S2
and a molecular weight of 149.20 g/mol. Its IUPAC name is 4-methyl-1,2,4-dithiazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-methyl-1,2,4-dithiazolidine-3,5-dione |
| PubChem CID | 6539161 |
| Molecular Formula | C3H3NO2S2 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 148.96 |
| IUPAC Name | 4-methyl-1,2,4-dithiazolidine-3,5-dione |
| SMILES | Cn1c(=O)ssc1=O |
| InChI | InChI=1S/C3H3NO2S2/c1-4-2(5)7-8-3(4)6/h1H3 |
| InChIKey | JJEIFYGMXLHTNE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-1,2,4-dithiazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2,4-dithiazolidine-3,5-dione?
The IUPAC name of 4-methyl-1,2,4-dithiazolidine-3,5-dione (CID 6539161) is 4-methyl-1,2,4-dithiazolidine-3,5-dione.
What is the SMILES notation for 4-methyl-1,2,4-dithiazolidine-3,5-dione?
The canonical SMILES for 4-methyl-1,2,4-dithiazolidine-3,5-dione is Cn1c(=O)ssc1=O.
What is the InChIKey of 4-methyl-1,2,4-dithiazolidine-3,5-dione?
The InChIKey is JJEIFYGMXLHTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3NO2S2/c1-4-2(5)7-8-3(4)6/h1H3.
What are the key properties of 4-methyl-1,2,4-dithiazolidine-3,5-dione?
4-methyl-1,2,4-dithiazolidine-3,5-dione has a molecular weight of 149.20 g/mol, XLogP of -0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2,4-dithiazolidine-3,5-dione is sourced from PubChem (CID 6539161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).