C10H11N3O2 — CID 6539163
1,2-dimethyl-4-phenyl-1,2,4-triazolidine-3,5-dione (PubChem CID 6539163) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 1,2-dimethyl-4-phenyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1,2-dimethyl-4-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 6539163 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 1,2-dimethyl-4-phenyl-1,2,4-triazolidine-3,5-dione |
| SMILES | Cn1c(=O)n(-c2ccccc2)c(=O)n1C |
| InChI | InChI=1S/C10H11N3O2/c1-11-9(14)13(10(15)12(11)2)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | PCBZEWNZJVJTIO-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |