C10H9N3O4S — CID 6539173
2-ethyl-4-(4-nitrophenyl)-1,2,4-thiadiazolidine-3,5-dione (PubChem CID 6539173) has the molecular formula C10H9N3O4S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-ethyl-4-(4-nitrophenyl)-1,2,4-thiadiazolidine-3,5-dione.
| Compound Name | 2-ethyl-4-(4-nitrophenyl)-1,2,4-thiadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 6539173 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-ethyl-4-(4-nitrophenyl)-1,2,4-thiadiazolidine-3,5-dione |
| SMILES | CCn1sc(=O)n(-c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C10H9N3O4S/c1-2-11-9(14)12(10(15)18-11)7-3-5-8(6-4-7)13(16)17/h3-6H,2H2,1H3 |
| InChIKey | NDJXFBOMEIBNON-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|