About 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide
2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide (PubChem CID 6539207) has the molecular formula C16H21N3O2S
and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide |
| PubChem CID | 6539207 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide |
| SMILES | COc1ccc(CC(=S)NCCCn2ccnc2)cc1OC |
| InChI | InChI=1S/C16H21N3O2S/c1-20-14-5-4-13(10-15(14)21-2)11-16(22)18-6-3-8-19-9-7-17-12-19/h4-5,7,9-10,12H,3,6,8,11H2,1-2H3,(H,18,22) |
| InChIKey | OHXZLILWGCLLQM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide (CID 6539207) is 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide is COc1ccc(CC(=S)NCCCn2ccnc2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide?
The InChIKey is OHXZLILWGCLLQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2S/c1-20-14-5-4-13(10-15(14)21-2)11-16(22)18-6-3-8-19-9-7-17-12-19/h4-5,7,9-10,12H,3,6,8,11H2,1-2H3,(H,18,22).
What are the key properties of 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide?
2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide has a molecular weight of 319.43 g/mol, XLogP of 2.45, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-N-(3-imidazol-1-ylpropyl)ethanethioamide is sourced from PubChem (CID 6539207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).