C30H45N3O4 — CID 6539259
(3S,4S)-N-butyl-3-hydroxy-6-methyl-4-[[(2S)-3-methyl-2-[(2-naphthalen-2-ylacetyl)amino]pentanoyl]amino]heptanamide (PubChem CID 6539259) has the molecular formula C30H45N3O4 and a molecular weight of 511.71 g/mol. Its IUPAC name is (3S,4S)-N-butyl-3-hydroxy-6-methyl-4-[[(2S)-3-methyl-2-[(2-naphthalen-2-ylacetyl)amino]pentanoyl]amino]heptanamide.
| Compound Name | (3S,4S)-N-butyl-3-hydroxy-6-methyl-4-[[(2S)-3-methyl-2-[(2-naphthalen-2-ylacetyl)amino]pentanoyl]amino]heptanamide |
|---|---|
| PubChem CID | 6539259 |
| Molecular Formula | C30H45N3O4 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | (3S,4S)-N-butyl-3-hydroxy-6-methyl-4-[[(2S)-3-methyl-2-[(2-naphthalen-2-ylacetyl)amino]pentanoyl]amino]heptanamide |
| SMILES | CCCCNC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)Cc1ccc2ccccc2c1)C(C)CC |
| InChI | InChI=1S/C30H45N3O4/c1-6-8-15-31-27(35)19-26(34)25(16-20(3)4)32-30(37)29(21(5)7-2)33-28(36)18-22-13-14-23-11-9-10-12-24(23)17-22/h9-14,17,20-21,25-26,29,34H,6-8,15-16,18-19H2,1-5H3,(H,31,35)(H,32,37)(H,33,36)/t21?,25-,26-,29-/m0/s1 |
| InChIKey | YHTKRGDAFFBWEU-BGRUSPQTSA-N |
| XLogP | 4.11 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|