C37H43N5O5 — CID 6539271
Hydroxyethylamine-based inhibitor 17d (PubChem CID 6539271) has the molecular formula C37H43N5O5 and a molecular weight of 637.80 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S,3S)-4-[[(2S)-1-amino-3-[3-(2-methoxyphenyl)phenyl]-1-oxopropan-2-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]pyridine-2-carboxamide.
| Compound Name | Hydroxyethylamine-based inhibitor 17d |
|---|---|
| PubChem CID | 6539271 |
| Molecular Formula | C37H43N5O5 |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | N-[(2S)-1-[[(2S,3S)-4-[[(2S)-1-amino-3-[3-(2-methoxyphenyl)phenyl]-1-oxopropan-2-yl]amino]-3-hydroxy-1-phenylbutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]pyridine-2-carboxamide |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)[C@H](CN[C@@H](CC2=CC(=CC=C2)C3=CC=CC=C3OC)C(=O)N)O)NC(=O)C4=CC=CC=N4 |
| InChI | InChI=1S/C37H43N5O5/c1-24(2)34(42-36(45)29-17-9-10-19-39-29)37(46)41-30(21-25-12-5-4-6-13-25)32(43)23-40-31(35(38)44)22-26-14-11-15-27(20-26)28-16-7-8-18-33(28)47-3/h4-20,24,30-32,34,40,43H,21-23H2,1-3H3,(H2,38,44)(H,41,46)(H,42,45)/t30-,31-,32-,34-/m0/s1 |
| InChIKey | NHXBRMTYDNOYDY-SUGCFTRWSA-N |
| XLogP | 4.70 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | 975 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |