About N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine
N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine (PubChem CID 6539359) has the molecular formula C16H12N6
and a molecular weight of 288.31 g/mol. Its IUPAC name is N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine |
| PubChem CID | 6539359 |
| Molecular Formula | C16H12N6 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine |
| SMILES | c1ccc(Nc2nccc(-c3cnn4ncccc34)n2)cc1 |
| InChI | InChI=1S/C16H12N6/c1-2-5-12(6-3-1)20-16-17-10-8-14(21-16)13-11-19-22-15(13)7-4-9-18-22/h1-11H,(H,17,20,21) |
| InChIKey | LIYXXFOSHNQSRD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine?
The IUPAC name of N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine (CID 6539359) is N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine.
What is the SMILES notation for N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine?
The canonical SMILES for N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine is c1ccc(Nc2nccc(-c3cnn4ncccc34)n2)cc1.
What is the InChIKey of N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine?
The InChIKey is LIYXXFOSHNQSRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N6/c1-2-5-12(6-3-1)20-16-17-10-8-14(21-16)13-11-19-22-15(13)7-4-9-18-22/h1-11H,(H,17,20,21).
What are the key properties of N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine?
N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine has a molecular weight of 288.31 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine is sourced from PubChem (CID 6539359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).