About 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one
3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one (PubChem CID 6539380) has the molecular formula C17H11F3N6O
and a molecular weight of 372.31 g/mol. Its IUPAC name is 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one |
| PubChem CID | 6539380 |
| Molecular Formula | C17H11F3N6O |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one |
| SMILES | O=c1ccc2c(-c3ccnc(Nc4cccc(C(F)(F)F)c4)n3)cnn2[nH]1 |
| InChI | InChI=1S/C17H11F3N6O/c18-17(19,20)10-2-1-3-11(8-10)23-16-21-7-6-13(24-16)12-9-22-26-14(12)4-5-15(27)25-26/h1-9H,(H,25,27)(H,21,23,24) |
| InChIKey | FEQLPEIKSCUTRT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one?
The IUPAC name of 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one (CID 6539380) is 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one.
What is the SMILES notation for 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one?
The canonical SMILES for 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one is O=c1ccc2c(-c3ccnc(Nc4cccc(C(F)(F)F)c4)n3)cnn2[nH]1.
What is the InChIKey of 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one?
The InChIKey is FEQLPEIKSCUTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F3N6O/c18-17(19,20)10-2-1-3-11(8-10)23-16-21-7-6-13(24-16)12-9-22-26-14(12)4-5-15(27)25-26/h1-9H,(H,25,27)(H,21,23,24).
What are the key properties of 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one?
3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one has a molecular weight of 372.31 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-7H-pyrazolo[1,5-b]pyridazin-6-one is sourced from PubChem (CID 6539380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).