C14H19BrO2S — CID 65394122
1-[(4-bromothiophen-2-yl)methyl]-4-ethylcyclohexane-1-carboxylic acid (PubChem CID 65394122) has the molecular formula C14H19BrO2S and a molecular weight of 331.28 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-4-ethylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-4-ethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65394122 |
| Molecular Formula | C14H19BrO2S |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-4-ethylcyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(Cc2cc(Br)cs2)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H19BrO2S/c1-2-10-3-5-14(6-4-10,13(16)17)8-12-7-11(15)9-18-12/h7,9-10H,2-6,8H2,1H3,(H,16,17) |
| InChIKey | HOOUWYWCSTVNAY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |