About 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine
4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine (PubChem CID 6539446) has the molecular formula C19H14F2N6
and a molecular weight of 364.36 g/mol. Its IUPAC name is 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine |
| PubChem CID | 6539446 |
| Molecular Formula | C19H14F2N6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine |
| SMILES | Fc1ccc(Nc2nccc(-c3c(C4CC4)nn4ncccc34)n2)cc1F |
| InChI | InChI=1S/C19H14F2N6/c20-13-6-5-12(10-14(13)21)24-19-22-9-7-15(25-19)17-16-2-1-8-23-27(16)26-18(17)11-3-4-11/h1-2,5-11H,3-4H2,(H,22,24,25) |
| InChIKey | JDLIQIUDELHLFR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine?
The IUPAC name of 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine (CID 6539446) is 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine.
What is the SMILES notation for 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine?
The canonical SMILES for 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine is Fc1ccc(Nc2nccc(-c3c(C4CC4)nn4ncccc34)n2)cc1F.
What is the InChIKey of 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine?
The InChIKey is JDLIQIUDELHLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N6/c20-13-6-5-12(10-14(13)21)24-19-22-9-7-15(25-19)17-16-2-1-8-23-27(16)26-18(17)11-3-4-11/h1-2,5-11H,3-4H2,(H,22,24,25).
What are the key properties of 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine?
4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine has a molecular weight of 364.36 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclopropylpyrazolo[1,5-b]pyridazin-3-yl)-N-(3,4-difluorophenyl)pyrimidin-2-amine is sourced from PubChem (CID 6539446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).