C17H13ClN2O3 — CID 6539464
3-(3-chloroanilino)-4-(4-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 6539464) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is 3-(3-chloroanilino)-4-(4-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3-chloroanilino)-4-(4-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 6539464 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-(3-chloroanilino)-4-(4-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Nc3cccc(Cl)c3)C(=O)NC2=O)cc1 |
| InChI | InChI=1S/C17H13ClN2O3/c1-23-13-7-5-10(6-8-13)14-15(17(22)20-16(14)21)19-12-4-2-3-11(18)9-12/h2-9H,1H3,(H2,19,20,21,22) |
| InChIKey | ANHNZYQVWLXJET-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|