About 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid
3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid (PubChem CID 6539496) has the molecular formula C17H11ClN2O4
and a molecular weight of 342.74 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
| PubChem CID | 6539496 |
| Molecular Formula | C17H11ClN2O4 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid |
| SMILES | O=C1NC(=O)C(c2ccc(Cl)cc2)=C1Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H11ClN2O4/c18-11-6-4-9(5-7-11)13-14(16(22)20-15(13)21)19-12-3-1-2-10(8-12)17(23)24/h1-8H,(H,23,24)(H2,19,20,21,22) |
| InChIKey | DGICZXPTVAKIDT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid?
The IUPAC name of 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid (CID 6539496) is 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid.
What is the SMILES notation for 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid?
The canonical SMILES for 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid is O=C1NC(=O)C(c2ccc(Cl)cc2)=C1Nc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid?
The InChIKey is DGICZXPTVAKIDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN2O4/c18-11-6-4-9(5-7-11)13-14(16(22)20-15(13)21)19-12-3-1-2-10(8-12)17(23)24/h1-8H,(H,23,24)(H2,19,20,21,22).
What are the key properties of 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid?
3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid has a molecular weight of 342.74 g/mol, XLogP of 2.52, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoic acid is sourced from PubChem (CID 6539496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).