About 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine
5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine (PubChem CID 6539529) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine.
Molecular Properties
| Compound Name | 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine |
| PubChem CID | 6539529 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine |
| SMILES | Nc1n[nH]c2cnc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C12H10N4/c13-12-9-6-10(8-4-2-1-3-5-8)14-7-11(9)15-16-12/h1-7H,(H3,13,15,16) |
| InChIKey | LZRFNYHUQSRPCO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine?
The IUPAC name of 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine (CID 6539529) is 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine.
What is the SMILES notation for 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine?
The canonical SMILES for 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine is Nc1n[nH]c2cnc(-c3ccccc3)cc12.
What is the InChIKey of 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine?
The InChIKey is LZRFNYHUQSRPCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4/c13-12-9-6-10(8-4-2-1-3-5-8)14-7-11(9)15-16-12/h1-7H,(H3,13,15,16).
What are the key properties of 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine?
5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine has a molecular weight of 210.24 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1H-pyrazolo[3,4-c]pyridin-3-amine is sourced from PubChem (CID 6539529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).